C19H15ClN4O5 — CID 108826959
ethyl 2-[[(Z)-3-(4-chloro-3-nitroanilino)-2-cyanoprop-2-enoyl]amino]benzoate (PubChem CID 108826959) has the molecular formula C19H15ClN4O5 and a molecular weight of 414.81 g/mol. Its IUPAC name is ethyl 2-[[(Z)-3-(4-chloro-3-nitroanilino)-2-cyanoprop-2-enoyl]amino]benzoate.
| Compound Name | ethyl 2-[[(Z)-3-(4-chloro-3-nitroanilino)-2-cyanoprop-2-enoyl]amino]benzoate |
|---|---|
| PubChem CID | 108826959 |
| Molecular Formula | C19H15ClN4O5 |
| Molecular Weight | 414.81 g/mol |
| Exact Mass | 414.07 |
| IUPAC Name | ethyl 2-[[(Z)-3-(4-chloro-3-nitroanilino)-2-cyanoprop-2-enoyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccccc1NC(=O)/C(C#N)=C\Nc1ccc(Cl)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C19H15ClN4O5/c1-2-29-19(26)14-5-3-4-6-16(14)23-18(25)12(10-21)11-22-13-7-8-15(20)17(9-13)24(27)28/h3-9,11,22H,2H2,1H3,(H,23,25)/b12-11- |
| InChIKey | FSRHRRBMIYZUCP-QXMHVHEDSA-N |
| XLogP | 3.88 |
| TPSA | 134.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.81 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|