C21H19ClN4O5 — CID 108855944
butyl 2-[[(Z)-3-(4-chloro-3-nitroanilino)-2-cyanoprop-2-enoyl]amino]benzoate (PubChem CID 108855944) has the molecular formula C21H19ClN4O5 and a molecular weight of 442.86 g/mol. Its IUPAC name is butyl 2-[[(Z)-3-(4-chloro-3-nitroanilino)-2-cyanoprop-2-enoyl]amino]benzoate.
| Compound Name | butyl 2-[[(Z)-3-(4-chloro-3-nitroanilino)-2-cyanoprop-2-enoyl]amino]benzoate |
|---|---|
| PubChem CID | 108855944 |
| Molecular Formula | C21H19ClN4O5 |
| Molecular Weight | 442.86 g/mol |
| Exact Mass | 442.10 |
| IUPAC Name | butyl 2-[[(Z)-3-(4-chloro-3-nitroanilino)-2-cyanoprop-2-enoyl]amino]benzoate |
| SMILES | CCCCOC(=O)c1ccccc1NC(=O)/C(C#N)=C\Nc1ccc(Cl)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C21H19ClN4O5/c1-2-3-10-31-21(28)16-6-4-5-7-18(16)25-20(27)14(12-23)13-24-15-8-9-17(22)19(11-15)26(29)30/h4-9,11,13,24H,2-3,10H2,1H3,(H,25,27)/b14-13- |
| InChIKey | TUFJKQOKXNRLHD-YPKPFQOOSA-N |
| XLogP | 4.66 |
| TPSA | 134.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.86 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|