C16H9BrN2O4 — CID 2964031
3-(6-bromo-1,3-benzodioxol-5-yl)-2-(3-nitrophenyl)prop-2-enenitrile (PubChem CID 2964031) has the molecular formula C16H9BrN2O4 and a molecular weight of 373.16 g/mol. Its IUPAC name is 3-(6-bromo-1,3-benzodioxol-5-yl)-2-(3-nitrophenyl)prop-2-enenitrile.
| Compound Name | 3-(6-bromo-1,3-benzodioxol-5-yl)-2-(3-nitrophenyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 2964031 |
| Molecular Formula | C16H9BrN2O4 |
| Molecular Weight | 373.16 g/mol |
| Exact Mass | 371.97 |
| IUPAC Name | 3-(6-bromo-1,3-benzodioxol-5-yl)-2-(3-nitrophenyl)prop-2-enenitrile |
| SMILES | N#CC(=Cc1cc2c(cc1Br)OCO2)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C16H9BrN2O4/c17-14-7-16-15(22-9-23-16)6-11(14)4-12(8-18)10-2-1-3-13(5-10)19(20)21/h1-7H,9H2 |
| InChIKey | NRTFOYUVAWVPJR-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 85.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.16 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|