C16H10BrNO5 — CID 2880704
3-(6-bromo-1,3-benzodioxol-5-yl)-1-(3-nitrophenyl)prop-2-en-1-one (PubChem CID 2880704) has the molecular formula C16H10BrNO5 and a molecular weight of 376.16 g/mol. Its IUPAC name is 3-(6-bromo-1,3-benzodioxol-5-yl)-1-(3-nitrophenyl)prop-2-en-1-one.
| Compound Name | 3-(6-bromo-1,3-benzodioxol-5-yl)-1-(3-nitrophenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 2880704 |
| Molecular Formula | C16H10BrNO5 |
| Molecular Weight | 376.16 g/mol |
| Exact Mass | 374.97 |
| IUPAC Name | 3-(6-bromo-1,3-benzodioxol-5-yl)-1-(3-nitrophenyl)prop-2-en-1-one |
| SMILES | O=C(C=Cc1cc2c(cc1Br)OCO2)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C16H10BrNO5/c17-13-8-16-15(22-9-23-16)7-10(13)4-5-14(19)11-2-1-3-12(6-11)18(20)21/h1-8H,9H2 |
| InChIKey | UTXOPTQSWOARRD-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 78.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.16 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|