C16H11NO6 — CID 19562768
(E)-1-(3-hydroxyphenyl)-3-(6-nitro-1,3-benzodioxol-5-yl)prop-2-en-1-one (PubChem CID 19562768) has the molecular formula C16H11NO6 and a molecular weight of 313.27 g/mol. Its IUPAC name is (E)-1-(3-hydroxyphenyl)-3-(6-nitro-1,3-benzodioxol-5-yl)prop-2-en-1-one.
| Compound Name | (E)-1-(3-hydroxyphenyl)-3-(6-nitro-1,3-benzodioxol-5-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 19562768 |
| Molecular Formula | C16H11NO6 |
| Molecular Weight | 313.27 g/mol |
| Exact Mass | 313.06 |
| IUPAC Name | (E)-1-(3-hydroxyphenyl)-3-(6-nitro-1,3-benzodioxol-5-yl)prop-2-en-1-one |
| SMILES | O=C(/C=C/c1cc2c(cc1[N+](=O)[O-])OCO2)c1cccc(O)c1 |
| InChI | InChI=1S/C16H11NO6/c18-12-3-1-2-11(6-12)14(19)5-4-10-7-15-16(23-9-22-15)8-13(10)17(20)21/h1-8,18H,9H2/b5-4+ |
| InChIKey | GUQNVTQOONVJPA-SNAWJCMRSA-N |
| XLogP | 2.93 |
| TPSA | 98.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.27 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|