C18H12N2O5 — CID 17139302
2-[(E)-2-(6-nitro-1,3-benzodioxol-5-yl)ethenyl]quinolin-8-ol (PubChem CID 17139302) has the molecular formula C18H12N2O5 and a molecular weight of 336.30 g/mol. Its IUPAC name is 2-[(E)-2-(6-nitro-1,3-benzodioxol-5-yl)ethenyl]quinolin-8-ol.
| Compound Name | 2-[(E)-2-(6-nitro-1,3-benzodioxol-5-yl)ethenyl]quinolin-8-ol |
|---|---|
| PubChem CID | 17139302 |
| Molecular Formula | C18H12N2O5 |
| Molecular Weight | 336.30 g/mol |
| Exact Mass | 336.07 |
| IUPAC Name | 2-[(E)-2-(6-nitro-1,3-benzodioxol-5-yl)ethenyl]quinolin-8-ol |
| SMILES | O=[N+]([O-])c1cc2c(cc1/C=C/c1ccc3cccc(O)c3n1)OCO2 |
| InChI | InChI=1S/C18H12N2O5/c21-15-3-1-2-11-4-6-13(19-18(11)15)7-5-12-8-16-17(25-10-24-16)9-14(12)20(22)23/h1-9,21H,10H2/b7-5+ |
| InChIKey | YHWJUAAJPOPDDF-FNORWQNLSA-N |
| XLogP | 3.75 |
| TPSA | 94.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.30 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|