C18H13N3O8 — CID 161373330
5H-[1,3]dioxolo[4,5-f]indole;5-nitro-6-[(E)-2-nitroethenyl]-1,3-benzodioxole (PubChem CID 161373330) has the molecular formula C18H13N3O8 and a molecular weight of 399.32 g/mol. Its IUPAC name is 5H-[1,3]dioxolo[4,5-f]indole;5-nitro-6-[(E)-2-nitroethenyl]-1,3-benzodioxole.
| Compound Name | 5H-[1,3]dioxolo[4,5-f]indole;5-nitro-6-[(E)-2-nitroethenyl]-1,3-benzodioxole |
|---|---|
| PubChem CID | 161373330 |
| Molecular Formula | C18H13N3O8 |
| Molecular Weight | 399.32 g/mol |
| Exact Mass | 399.07 |
| IUPAC Name | 5H-[1,3]dioxolo[4,5-f]indole;5-nitro-6-[(E)-2-nitroethenyl]-1,3-benzodioxole |
| SMILES | O=[N+]([O-])/C=C/c1cc2c(cc1[N+](=O)[O-])OCO2.c1cc2cc3c(cc2[nH]1)OCO3 |
| InChI | InChI=1S/C9H6N2O6.C9H7NO2/c12-10(13)2-1-6-3-8-9(17-5-16-8)4-7(6)11(14)15;1-2-10-7-4-9-8(3-6(1)7)11-5-12-9/h1-4H,5H2;1-4,10H,5H2/b2-1+; |
| InChIKey | VQTFDEDFGAHYJW-TYYBGVCCSA-N |
| XLogP | 3.47 |
| TPSA | 138.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.32 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|