C13H12N2O7 — CID 69443624
2-[methyl-[(E)-3-(6-nitro-1,3-benzodioxol-5-yl)prop-2-enoyl]amino]acetic acid (PubChem CID 69443624) has the molecular formula C13H12N2O7 and a molecular weight of 308.25 g/mol. Its IUPAC name is 2-[methyl-[(E)-3-(6-nitro-1,3-benzodioxol-5-yl)prop-2-enoyl]amino]acetic acid.
| Compound Name | 2-[methyl-[(E)-3-(6-nitro-1,3-benzodioxol-5-yl)prop-2-enoyl]amino]acetic acid |
|---|---|
| PubChem CID | 69443624 |
| Molecular Formula | C13H12N2O7 |
| Molecular Weight | 308.25 g/mol |
| Exact Mass | 308.06 |
| IUPAC Name | 2-[methyl-[(E)-3-(6-nitro-1,3-benzodioxol-5-yl)prop-2-enoyl]amino]acetic acid |
| SMILES | CN(CC(=O)O)C(=O)/C=C/c1cc2c(cc1[N+](=O)[O-])OCO2 |
| InChI | InChI=1S/C13H12N2O7/c1-14(6-13(17)18)12(16)3-2-8-4-10-11(22-7-21-10)5-9(8)15(19)20/h2-5H,6-7H2,1H3,(H,17,18)/b3-2+ |
| InChIKey | ZVDQVOYQHZQFAO-NSCUHMNNSA-N |
| XLogP | 0.88 |
| TPSA | 119.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.25 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|