C17H12N2O8 — CID 8653212
(4-nitrophenyl)methyl (E)-3-(6-nitro-1,3-benzodioxol-5-yl)prop-2-enoate (PubChem CID 8653212) has the molecular formula C17H12N2O8 and a molecular weight of 372.29 g/mol. Its IUPAC name is (4-nitrophenyl)methyl (E)-3-(6-nitro-1,3-benzodioxol-5-yl)prop-2-enoate.
| Compound Name | (4-nitrophenyl)methyl (E)-3-(6-nitro-1,3-benzodioxol-5-yl)prop-2-enoate |
|---|---|
| PubChem CID | 8653212 |
| Molecular Formula | C17H12N2O8 |
| Molecular Weight | 372.29 g/mol |
| Exact Mass | 372.06 |
| IUPAC Name | (4-nitrophenyl)methyl (E)-3-(6-nitro-1,3-benzodioxol-5-yl)prop-2-enoate |
| SMILES | O=C(/C=C/c1cc2c(cc1[N+](=O)[O-])OCO2)OCc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C17H12N2O8/c20-17(25-9-11-1-4-13(5-2-11)18(21)22)6-3-12-7-15-16(27-10-26-15)8-14(12)19(23)24/h1-8H,9-10H2/b6-3+ |
| InChIKey | FQNBXSSUCANZRZ-ZZXKWVIFSA-N |
| XLogP | 2.99 |
| TPSA | 131.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.29 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|