C17H12FNO6 — CID 8654049
(3-fluorophenyl)methyl (E)-3-(6-nitro-1,3-benzodioxol-5-yl)prop-2-enoate (PubChem CID 8654049) has the molecular formula C17H12FNO6 and a molecular weight of 345.28 g/mol. Its IUPAC name is (3-fluorophenyl)methyl (E)-3-(6-nitro-1,3-benzodioxol-5-yl)prop-2-enoate.
| Compound Name | (3-fluorophenyl)methyl (E)-3-(6-nitro-1,3-benzodioxol-5-yl)prop-2-enoate |
|---|---|
| PubChem CID | 8654049 |
| Molecular Formula | C17H12FNO6 |
| Molecular Weight | 345.28 g/mol |
| Exact Mass | 345.06 |
| IUPAC Name | (3-fluorophenyl)methyl (E)-3-(6-nitro-1,3-benzodioxol-5-yl)prop-2-enoate |
| SMILES | O=C(/C=C/c1cc2c(cc1[N+](=O)[O-])OCO2)OCc1cccc(F)c1 |
| InChI | InChI=1S/C17H12FNO6/c18-13-3-1-2-11(6-13)9-23-17(20)5-4-12-7-15-16(25-10-24-15)8-14(12)19(21)22/h1-8H,9-10H2/b5-4+ |
| InChIKey | VVARVDFJUNFYBA-SNAWJCMRSA-N |
| XLogP | 3.22 |
| TPSA | 87.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.28 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|