C17H12ClFO4 — CID 8661203
(3-fluorophenyl)methyl (E)-3-(7-chloro-1,3-benzodioxol-5-yl)prop-2-enoate (PubChem CID 8661203) has the molecular formula C17H12ClFO4 and a molecular weight of 334.73 g/mol. Its IUPAC name is (3-fluorophenyl)methyl (E)-3-(7-chloro-1,3-benzodioxol-5-yl)prop-2-enoate.
| Compound Name | (3-fluorophenyl)methyl (E)-3-(7-chloro-1,3-benzodioxol-5-yl)prop-2-enoate |
|---|---|
| PubChem CID | 8661203 |
| Molecular Formula | C17H12ClFO4 |
| Molecular Weight | 334.73 g/mol |
| Exact Mass | 334.04 |
| IUPAC Name | (3-fluorophenyl)methyl (E)-3-(7-chloro-1,3-benzodioxol-5-yl)prop-2-enoate |
| SMILES | O=C(/C=C/c1cc(Cl)c2c(c1)OCO2)OCc1cccc(F)c1 |
| InChI | InChI=1S/C17H12ClFO4/c18-14-7-11(8-15-17(14)23-10-22-15)4-5-16(20)21-9-12-2-1-3-13(19)6-12/h1-8H,9-10H2/b5-4+ |
| InChIKey | DXADZIISKWOFMP-SNAWJCMRSA-N |
| XLogP | 3.96 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.73 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|