C16H12ClNO4 — CID 76865634
pyridin-2-ylmethyl 3-(7-chloro-1,3-benzodioxol-5-yl)prop-2-enoate (PubChem CID 76865634) has the molecular formula C16H12ClNO4 and a molecular weight of 317.73 g/mol. Its IUPAC name is pyridin-2-ylmethyl 3-(7-chloro-1,3-benzodioxol-5-yl)prop-2-enoate.
| Compound Name | pyridin-2-ylmethyl 3-(7-chloro-1,3-benzodioxol-5-yl)prop-2-enoate |
|---|---|
| PubChem CID | 76865634 |
| Molecular Formula | C16H12ClNO4 |
| Molecular Weight | 317.73 g/mol |
| Exact Mass | 317.05 |
| IUPAC Name | pyridin-2-ylmethyl 3-(7-chloro-1,3-benzodioxol-5-yl)prop-2-enoate |
| SMILES | O=C(C=Cc1cc(Cl)c2c(c1)OCO2)OCc1ccccn1 |
| InChI | InChI=1S/C16H12ClNO4/c17-13-7-11(8-14-16(13)22-10-21-14)4-5-15(19)20-9-12-3-1-2-6-18-12/h1-8H,9-10H2 |
| InChIKey | RYRMCPWQLXYAJO-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 57.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.73 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|