C18H12ClNO5S — CID 8945706
(5-thiophen-2-yl-1,2-oxazol-3-yl)methyl (E)-3-(7-chloro-1,3-benzodioxol-5-yl)prop-2-enoate (PubChem CID 8945706) has the molecular formula C18H12ClNO5S and a molecular weight of 389.82 g/mol. Its IUPAC name is (5-thiophen-2-yl-1,2-oxazol-3-yl)methyl (E)-3-(7-chloro-1,3-benzodioxol-5-yl)prop-2-enoate.
| Compound Name | (5-thiophen-2-yl-1,2-oxazol-3-yl)methyl (E)-3-(7-chloro-1,3-benzodioxol-5-yl)prop-2-enoate |
|---|---|
| PubChem CID | 8945706 |
| Molecular Formula | C18H12ClNO5S |
| Molecular Weight | 389.82 g/mol |
| Exact Mass | 389.01 |
| IUPAC Name | (5-thiophen-2-yl-1,2-oxazol-3-yl)methyl (E)-3-(7-chloro-1,3-benzodioxol-5-yl)prop-2-enoate |
| SMILES | O=C(/C=C/c1cc(Cl)c2c(c1)OCO2)OCc1cc(-c2cccs2)on1 |
| InChI | InChI=1S/C18H12ClNO5S/c19-13-6-11(7-15-18(13)24-10-23-15)3-4-17(21)22-9-12-8-14(25-20-12)16-2-1-5-26-16/h1-8H,9-10H2/b4-3+ |
| InChIKey | PDXJIWKOCNEFDY-ONEGZZNKSA-N |
| XLogP | 4.54 |
| TPSA | 70.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.82 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|