C15H12ClNO5 — CID 9063219
(5-methyl-1,2-oxazol-3-yl)methyl (E)-3-(7-chloro-1,3-benzodioxol-5-yl)prop-2-enoate (PubChem CID 9063219) has the molecular formula C15H12ClNO5 and a molecular weight of 321.72 g/mol. Its IUPAC name is (5-methyl-1,2-oxazol-3-yl)methyl (E)-3-(7-chloro-1,3-benzodioxol-5-yl)prop-2-enoate.
| Compound Name | (5-methyl-1,2-oxazol-3-yl)methyl (E)-3-(7-chloro-1,3-benzodioxol-5-yl)prop-2-enoate |
|---|---|
| PubChem CID | 9063219 |
| Molecular Formula | C15H12ClNO5 |
| Molecular Weight | 321.72 g/mol |
| Exact Mass | 321.04 |
| IUPAC Name | (5-methyl-1,2-oxazol-3-yl)methyl (E)-3-(7-chloro-1,3-benzodioxol-5-yl)prop-2-enoate |
| SMILES | Cc1cc(COC(=O)/C=C/c2cc(Cl)c3c(c2)OCO3)no1 |
| InChI | InChI=1S/C15H12ClNO5/c1-9-4-11(17-22-9)7-19-14(18)3-2-10-5-12(16)15-13(6-10)20-8-21-15/h2-6H,7-8H2,1H3/b3-2+ |
| InChIKey | HIMPWGAOSOSMAJ-NSCUHMNNSA-N |
| XLogP | 3.12 |
| TPSA | 70.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.72 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|