C17H17ClN2O4 — CID 72684849
2-(3,5-dimethylpyrazol-1-yl)ethyl 3-(7-chloro-1,3-benzodioxol-5-yl)prop-2-enoate (PubChem CID 72684849) has the molecular formula C17H17ClN2O4 and a molecular weight of 348.79 g/mol. Its IUPAC name is 2-(3,5-dimethylpyrazol-1-yl)ethyl 3-(7-chloro-1,3-benzodioxol-5-yl)prop-2-enoate.
| Compound Name | 2-(3,5-dimethylpyrazol-1-yl)ethyl 3-(7-chloro-1,3-benzodioxol-5-yl)prop-2-enoate |
|---|---|
| PubChem CID | 72684849 |
| Molecular Formula | C17H17ClN2O4 |
| Molecular Weight | 348.79 g/mol |
| Exact Mass | 348.09 |
| IUPAC Name | 2-(3,5-dimethylpyrazol-1-yl)ethyl 3-(7-chloro-1,3-benzodioxol-5-yl)prop-2-enoate |
| SMILES | Cc1cc(C)n(CCOC(=O)C=Cc2cc(Cl)c3c(c2)OCO3)n1 |
| InChI | InChI=1S/C17H17ClN2O4/c1-11-7-12(2)20(19-11)5-6-22-16(21)4-3-13-8-14(18)17-15(9-13)23-10-24-17/h3-4,7-9H,5-6,10H2,1-2H3 |
| InChIKey | OUHYLUPJGDLPRQ-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 62.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.79 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|