C17H13ClO7 — CID 8661183
methyl 5-[[(E)-3-(7-chloro-1,3-benzodioxol-5-yl)prop-2-enoyl]oxymethyl]furan-2-carboxylate (PubChem CID 8661183) has the molecular formula C17H13ClO7 and a molecular weight of 364.74 g/mol. Its IUPAC name is methyl 5-[[(E)-3-(7-chloro-1,3-benzodioxol-5-yl)prop-2-enoyl]oxymethyl]furan-2-carboxylate.
| Compound Name | methyl 5-[[(E)-3-(7-chloro-1,3-benzodioxol-5-yl)prop-2-enoyl]oxymethyl]furan-2-carboxylate |
|---|---|
| PubChem CID | 8661183 |
| Molecular Formula | C17H13ClO7 |
| Molecular Weight | 364.74 g/mol |
| Exact Mass | 364.03 |
| IUPAC Name | methyl 5-[[(E)-3-(7-chloro-1,3-benzodioxol-5-yl)prop-2-enoyl]oxymethyl]furan-2-carboxylate |
| SMILES | COC(=O)c1ccc(COC(=O)/C=C/c2cc(Cl)c3c(c2)OCO3)o1 |
| InChI | InChI=1S/C17H13ClO7/c1-21-17(20)13-4-3-11(25-13)8-22-15(19)5-2-10-6-12(18)16-14(7-10)23-9-24-16/h2-7H,8-9H2,1H3/b5-2+ |
| InChIKey | XHMLHIGRJUACIM-GORDUTHDSA-N |
| XLogP | 3.20 |
| TPSA | 84.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.74 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|