C19H22ClNO5 — CID 9059990
(5-methyl-1,2-oxazol-3-yl)methyl (E)-3-[3-chloro-5-methoxy-4-(2-methylpropoxy)phenyl]prop-2-enoate (PubChem CID 9059990) has the molecular formula C19H22ClNO5 and a molecular weight of 379.84 g/mol. Its IUPAC name is (5-methyl-1,2-oxazol-3-yl)methyl (E)-3-[3-chloro-5-methoxy-4-(2-methylpropoxy)phenyl]prop-2-enoate.
| Compound Name | (5-methyl-1,2-oxazol-3-yl)methyl (E)-3-[3-chloro-5-methoxy-4-(2-methylpropoxy)phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 9059990 |
| Molecular Formula | C19H22ClNO5 |
| Molecular Weight | 379.84 g/mol |
| Exact Mass | 379.12 |
| IUPAC Name | (5-methyl-1,2-oxazol-3-yl)methyl (E)-3-[3-chloro-5-methoxy-4-(2-methylpropoxy)phenyl]prop-2-enoate |
| SMILES | COc1cc(/C=C/C(=O)OCc2cc(C)on2)cc(Cl)c1OCC(C)C |
| InChI | InChI=1S/C19H22ClNO5/c1-12(2)10-25-19-16(20)8-14(9-17(19)23-4)5-6-18(22)24-11-15-7-13(3)26-21-15/h5-9,12H,10-11H2,1-4H3/b6-5+ |
| InChIKey | DTJCKHIBKCEINK-AATRIKPKSA-N |
| XLogP | 4.44 |
| TPSA | 70.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.84 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|