C20H21ClO5S — CID 7847960
(2-oxo-2-thiophen-2-ylethyl) (E)-3-[3-chloro-5-methoxy-4-(2-methylpropoxy)phenyl]prop-2-enoate (PubChem CID 7847960) has the molecular formula C20H21ClO5S and a molecular weight of 408.90 g/mol. Its IUPAC name is (2-oxo-2-thiophen-2-ylethyl) (E)-3-[3-chloro-5-methoxy-4-(2-methylpropoxy)phenyl]prop-2-enoate.
| Compound Name | (2-oxo-2-thiophen-2-ylethyl) (E)-3-[3-chloro-5-methoxy-4-(2-methylpropoxy)phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 7847960 |
| Molecular Formula | C20H21ClO5S |
| Molecular Weight | 408.90 g/mol |
| Exact Mass | 408.08 |
| IUPAC Name | (2-oxo-2-thiophen-2-ylethyl) (E)-3-[3-chloro-5-methoxy-4-(2-methylpropoxy)phenyl]prop-2-enoate |
| SMILES | COc1cc(/C=C/C(=O)OCC(=O)c2cccs2)cc(Cl)c1OCC(C)C |
| InChI | InChI=1S/C20H21ClO5S/c1-13(2)11-26-20-15(21)9-14(10-17(20)24-3)6-7-19(23)25-12-16(22)18-5-4-8-27-18/h4-10,13H,11-12H2,1-3H3/b7-6+ |
| InChIKey | DEPKYTQTZHHOBJ-VOTSOKGWSA-N |
| XLogP | 4.88 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.90 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|