C19H21ClN2O4S — CID 26469444
(E)-N-(4-acetyl-1,3-thiazol-2-yl)-3-[3-chloro-5-methoxy-4-(2-methylpropoxy)phenyl]prop-2-enamide (PubChem CID 26469444) has the molecular formula C19H21ClN2O4S and a molecular weight of 408.91 g/mol. Its IUPAC name is (E)-N-(4-acetyl-1,3-thiazol-2-yl)-3-[3-chloro-5-methoxy-4-(2-methylpropoxy)phenyl]prop-2-enamide.
| Compound Name | (E)-N-(4-acetyl-1,3-thiazol-2-yl)-3-[3-chloro-5-methoxy-4-(2-methylpropoxy)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 26469444 |
| Molecular Formula | C19H21ClN2O4S |
| Molecular Weight | 408.91 g/mol |
| Exact Mass | 408.09 |
| IUPAC Name | (E)-N-(4-acetyl-1,3-thiazol-2-yl)-3-[3-chloro-5-methoxy-4-(2-methylpropoxy)phenyl]prop-2-enamide |
| SMILES | COc1cc(/C=C/C(=O)Nc2nc(C(C)=O)cs2)cc(Cl)c1OCC(C)C |
| InChI | InChI=1S/C19H21ClN2O4S/c1-11(2)9-26-18-14(20)7-13(8-16(18)25-4)5-6-17(24)22-19-21-15(10-27-19)12(3)23/h5-8,10-11H,9H2,1-4H3,(H,21,22,24)/b6-5+ |
| InChIKey | YWGJGMPMHNEZDR-AATRIKPKSA-N |
| XLogP | 4.69 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.91 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|