C22H24ClN5O3 — CID 46468968
(E)-3-[3-chloro-5-methoxy-4-(2-methylpropoxy)phenyl]-N-[3-(5-methyltetrazol-1-yl)phenyl]prop-2-enamide (PubChem CID 46468968) has the molecular formula C22H24ClN5O3 and a molecular weight of 441.92 g/mol. Its IUPAC name is (E)-3-[3-chloro-5-methoxy-4-(2-methylpropoxy)phenyl]-N-[3-(5-methyltetrazol-1-yl)phenyl]prop-2-enamide.
| Compound Name | (E)-3-[3-chloro-5-methoxy-4-(2-methylpropoxy)phenyl]-N-[3-(5-methyltetrazol-1-yl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 46468968 |
| Molecular Formula | C22H24ClN5O3 |
| Molecular Weight | 441.92 g/mol |
| Exact Mass | 441.16 |
| IUPAC Name | (E)-3-[3-chloro-5-methoxy-4-(2-methylpropoxy)phenyl]-N-[3-(5-methyltetrazol-1-yl)phenyl]prop-2-enamide |
| SMILES | COc1cc(/C=C/C(=O)Nc2cccc(-n3nnnc3C)c2)cc(Cl)c1OCC(C)C |
| InChI | InChI=1S/C22H24ClN5O3/c1-14(2)13-31-22-19(23)10-16(11-20(22)30-4)8-9-21(29)24-17-6-5-7-18(12-17)28-15(3)25-26-27-28/h5-12,14H,13H2,1-4H3,(H,24,29)/b9-8+ |
| InChIKey | MTXXFIHCXVGQLF-CMDGGOBGSA-N |
| XLogP | 4.32 |
| TPSA | 91.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.92 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|