C24H29ClN2O4 — CID 46487356
(E)-3-[3-chloro-5-methoxy-4-(2-methylpropoxy)phenyl]-N-[2-methyl-5-(propanoylamino)phenyl]prop-2-enamide (PubChem CID 46487356) has the molecular formula C24H29ClN2O4 and a molecular weight of 444.96 g/mol. Its IUPAC name is (E)-3-[3-chloro-5-methoxy-4-(2-methylpropoxy)phenyl]-N-[2-methyl-5-(propanoylamino)phenyl]prop-2-enamide.
| Compound Name | (E)-3-[3-chloro-5-methoxy-4-(2-methylpropoxy)phenyl]-N-[2-methyl-5-(propanoylamino)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 46487356 |
| Molecular Formula | C24H29ClN2O4 |
| Molecular Weight | 444.96 g/mol |
| Exact Mass | 444.18 |
| IUPAC Name | (E)-3-[3-chloro-5-methoxy-4-(2-methylpropoxy)phenyl]-N-[2-methyl-5-(propanoylamino)phenyl]prop-2-enamide |
| SMILES | CCC(=O)Nc1ccc(C)c(NC(=O)/C=C/c2cc(Cl)c(OCC(C)C)c(OC)c2)c1 |
| InChI | InChI=1S/C24H29ClN2O4/c1-6-22(28)26-18-9-7-16(4)20(13-18)27-23(29)10-8-17-11-19(25)24(21(12-17)30-5)31-14-15(2)3/h7-13,15H,6,14H2,1-5H3,(H,26,28)(H,27,29)/b10-8+ |
| InChIKey | BBRAOPCQMCEDQG-CSKARUKUSA-N |
| XLogP | 5.69 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.96 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|