C21H23ClN2O4 — CID 56518330
4-[[(E)-3-(3-chloro-5-methoxy-4-propoxyphenyl)prop-2-enoyl]amino]-2-methylbenzamide (PubChem CID 56518330) has the molecular formula C21H23ClN2O4 and a molecular weight of 402.88 g/mol. Its IUPAC name is 4-[[(E)-3-(3-chloro-5-methoxy-4-propoxyphenyl)prop-2-enoyl]amino]-2-methylbenzamide.
| Compound Name | 4-[[(E)-3-(3-chloro-5-methoxy-4-propoxyphenyl)prop-2-enoyl]amino]-2-methylbenzamide |
|---|---|
| PubChem CID | 56518330 |
| Molecular Formula | C21H23ClN2O4 |
| Molecular Weight | 402.88 g/mol |
| Exact Mass | 402.13 |
| IUPAC Name | 4-[[(E)-3-(3-chloro-5-methoxy-4-propoxyphenyl)prop-2-enoyl]amino]-2-methylbenzamide |
| SMILES | CCCOc1c(Cl)cc(/C=C/C(=O)Nc2ccc(C(N)=O)c(C)c2)cc1OC |
| InChI | InChI=1S/C21H23ClN2O4/c1-4-9-28-20-17(22)11-14(12-18(20)27-3)5-8-19(25)24-15-6-7-16(21(23)26)13(2)10-15/h5-8,10-12H,4,9H2,1-3H3,(H2,23,26)(H,24,25)/b8-5+ |
| InChIKey | KFOQCEQVCHERRJ-VMPITWQZSA-N |
| XLogP | 4.20 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.88 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|