C20H19ClN2O3 — CID 26727852
(E)-3-(3-chloro-5-methoxy-4-propoxyphenyl)-N-(3-cyanophenyl)prop-2-enamide (PubChem CID 26727852) has the molecular formula C20H19ClN2O3 and a molecular weight of 370.84 g/mol. Its IUPAC name is (E)-3-(3-chloro-5-methoxy-4-propoxyphenyl)-N-(3-cyanophenyl)prop-2-enamide.
| Compound Name | (E)-3-(3-chloro-5-methoxy-4-propoxyphenyl)-N-(3-cyanophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 26727852 |
| Molecular Formula | C20H19ClN2O3 |
| Molecular Weight | 370.84 g/mol |
| Exact Mass | 370.11 |
| IUPAC Name | (E)-3-(3-chloro-5-methoxy-4-propoxyphenyl)-N-(3-cyanophenyl)prop-2-enamide |
| SMILES | CCCOc1c(Cl)cc(/C=C/C(=O)Nc2cccc(C#N)c2)cc1OC |
| InChI | InChI=1S/C20H19ClN2O3/c1-3-9-26-20-17(21)11-14(12-18(20)25-2)7-8-19(24)23-16-6-4-5-15(10-16)13-22/h4-8,10-12H,3,9H2,1-2H3,(H,23,24)/b8-7+ |
| InChIKey | ZFDPYMFQIIMPKD-BQYQJAHWSA-N |
| XLogP | 4.66 |
| TPSA | 71.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.84 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|