C23H20ClN3O4 — CID 39676845
N-[3-[[(E)-3-(3-chloro-4,5-dimethoxyphenyl)prop-2-enoyl]amino]phenyl]pyridine-4-carboxamide (PubChem CID 39676845) has the molecular formula C23H20ClN3O4 and a molecular weight of 437.88 g/mol. Its IUPAC name is N-[3-[[(E)-3-(3-chloro-4,5-dimethoxyphenyl)prop-2-enoyl]amino]phenyl]pyridine-4-carboxamide.
| Compound Name | N-[3-[[(E)-3-(3-chloro-4,5-dimethoxyphenyl)prop-2-enoyl]amino]phenyl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 39676845 |
| Molecular Formula | C23H20ClN3O4 |
| Molecular Weight | 437.88 g/mol |
| Exact Mass | 437.11 |
| IUPAC Name | N-[3-[[(E)-3-(3-chloro-4,5-dimethoxyphenyl)prop-2-enoyl]amino]phenyl]pyridine-4-carboxamide |
| SMILES | COc1cc(/C=C/C(=O)Nc2cccc(NC(=O)c3ccncc3)c2)cc(Cl)c1OC |
| InChI | InChI=1S/C23H20ClN3O4/c1-30-20-13-15(12-19(24)22(20)31-2)6-7-21(28)26-17-4-3-5-18(14-17)27-23(29)16-8-10-25-11-9-16/h3-14H,1-2H3,(H,26,28)(H,27,29)/b7-6+ |
| InChIKey | YXUBFNXBRDWHCF-VOTSOKGWSA-N |
| XLogP | 4.66 |
| TPSA | 89.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.88 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|