C21H20ClN3O5 — CID 55735522
(E)-3-(3-chloro-4,5-dimethoxyphenyl)-N-[3-(4-methyl-2,5-dioxoimidazolidin-4-yl)phenyl]prop-2-enamide (PubChem CID 55735522) has the molecular formula C21H20ClN3O5 and a molecular weight of 429.86 g/mol. Its IUPAC name is (E)-3-(3-chloro-4,5-dimethoxyphenyl)-N-[3-(4-methyl-2,5-dioxoimidazolidin-4-yl)phenyl]prop-2-enamide.
| Compound Name | (E)-3-(3-chloro-4,5-dimethoxyphenyl)-N-[3-(4-methyl-2,5-dioxoimidazolidin-4-yl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 55735522 |
| Molecular Formula | C21H20ClN3O5 |
| Molecular Weight | 429.86 g/mol |
| Exact Mass | 429.11 |
| IUPAC Name | (E)-3-(3-chloro-4,5-dimethoxyphenyl)-N-[3-(4-methyl-2,5-dioxoimidazolidin-4-yl)phenyl]prop-2-enamide |
| SMILES | COc1cc(/C=C/C(=O)Nc2cccc(C3(C)NC(=O)NC3=O)c2)cc(Cl)c1OC |
| InChI | InChI=1S/C21H20ClN3O5/c1-21(19(27)24-20(28)25-21)13-5-4-6-14(11-13)23-17(26)8-7-12-9-15(22)18(30-3)16(10-12)29-2/h4-11H,1-3H3,(H,23,26)(H2,24,25,27,28)/b8-7+ |
| InChIKey | VQCYFFUBKYEVCA-BQYQJAHWSA-N |
| XLogP | 3.06 |
| TPSA | 105.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.86 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|