C17H14Cl2FNO3 — CID 9146394
(E)-3-(3-chloro-4,5-dimethoxyphenyl)-N-(3-chloro-2-fluorophenyl)prop-2-enamide (PubChem CID 9146394) has the molecular formula C17H14Cl2FNO3 and a molecular weight of 370.21 g/mol. Its IUPAC name is (E)-3-(3-chloro-4,5-dimethoxyphenyl)-N-(3-chloro-2-fluorophenyl)prop-2-enamide.
| Compound Name | (E)-3-(3-chloro-4,5-dimethoxyphenyl)-N-(3-chloro-2-fluorophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 9146394 |
| Molecular Formula | C17H14Cl2FNO3 |
| Molecular Weight | 370.21 g/mol |
| Exact Mass | 369.03 |
| IUPAC Name | (E)-3-(3-chloro-4,5-dimethoxyphenyl)-N-(3-chloro-2-fluorophenyl)prop-2-enamide |
| SMILES | COc1cc(/C=C/C(=O)Nc2cccc(Cl)c2F)cc(Cl)c1OC |
| InChI | InChI=1S/C17H14Cl2FNO3/c1-23-14-9-10(8-12(19)17(14)24-2)6-7-15(22)21-13-5-3-4-11(18)16(13)20/h3-9H,1-2H3,(H,21,22)/b7-6+ |
| InChIKey | XXBBKFRYOBYTJE-VOTSOKGWSA-N |
| XLogP | 4.80 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.21 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|