C16H15F2NO5 — CID 8939747
(5-methyl-1,2-oxazol-3-yl)methyl (E)-3-[4-(difluoromethoxy)-3-methoxyphenyl]prop-2-enoate (PubChem CID 8939747) has the molecular formula C16H15F2NO5 and a molecular weight of 339.29 g/mol. Its IUPAC name is (5-methyl-1,2-oxazol-3-yl)methyl (E)-3-[4-(difluoromethoxy)-3-methoxyphenyl]prop-2-enoate.
| Compound Name | (5-methyl-1,2-oxazol-3-yl)methyl (E)-3-[4-(difluoromethoxy)-3-methoxyphenyl]prop-2-enoate |
|---|---|
| PubChem CID | 8939747 |
| Molecular Formula | C16H15F2NO5 |
| Molecular Weight | 339.29 g/mol |
| Exact Mass | 339.09 |
| IUPAC Name | (5-methyl-1,2-oxazol-3-yl)methyl (E)-3-[4-(difluoromethoxy)-3-methoxyphenyl]prop-2-enoate |
| SMILES | COc1cc(/C=C/C(=O)OCc2cc(C)on2)ccc1OC(F)F |
| InChI | InChI=1S/C16H15F2NO5/c1-10-7-12(19-24-10)9-22-15(20)6-4-11-3-5-13(23-16(17)18)14(8-11)21-2/h3-8,16H,9H2,1-2H3/b6-4+ |
| InChIKey | NSHRYLCUHOVIBH-GQCTYLIASA-N |
| XLogP | 3.35 |
| TPSA | 70.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.29 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|