C19H16FN3O6 — CID 9426934
(E)-N-[2-(4-fluoroanilino)-2-oxoethyl]-N-methyl-3-(6-nitro-1,3-benzodioxol-5-yl)prop-2-enamide (PubChem CID 9426934) has the molecular formula C19H16FN3O6 and a molecular weight of 401.35 g/mol. Its IUPAC name is (E)-N-[2-(4-fluoroanilino)-2-oxoethyl]-N-methyl-3-(6-nitro-1,3-benzodioxol-5-yl)prop-2-enamide.
| Compound Name | (E)-N-[2-(4-fluoroanilino)-2-oxoethyl]-N-methyl-3-(6-nitro-1,3-benzodioxol-5-yl)prop-2-enamide |
|---|---|
| PubChem CID | 9426934 |
| Molecular Formula | C19H16FN3O6 |
| Molecular Weight | 401.35 g/mol |
| Exact Mass | 401.10 |
| IUPAC Name | (E)-N-[2-(4-fluoroanilino)-2-oxoethyl]-N-methyl-3-(6-nitro-1,3-benzodioxol-5-yl)prop-2-enamide |
| SMILES | CN(CC(=O)Nc1ccc(F)cc1)C(=O)/C=C/c1cc2c(cc1[N+](=O)[O-])OCO2 |
| InChI | InChI=1S/C19H16FN3O6/c1-22(10-18(24)21-14-5-3-13(20)4-6-14)19(25)7-2-12-8-16-17(29-11-28-16)9-15(12)23(26)27/h2-9H,10-11H2,1H3,(H,21,24)/b7-2+ |
| InChIKey | SJUFEAATIAXSJF-FARCUNLSSA-N |
| XLogP | 2.57 |
| TPSA | 111.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.35 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|