C17H10Cl2N2O2 — CID 7972371
2-[(E)-2-(2,4-dichlorophenyl)ethenyl]-8-nitroquinoline (PubChem CID 7972371) has the molecular formula C17H10Cl2N2O2 and a molecular weight of 345.19 g/mol. Its IUPAC name is 2-[(E)-2-(2,4-dichlorophenyl)ethenyl]-8-nitroquinoline.
| Compound Name | 2-[(E)-2-(2,4-dichlorophenyl)ethenyl]-8-nitroquinoline |
|---|---|
| PubChem CID | 7972371 |
| Molecular Formula | C17H10Cl2N2O2 |
| Molecular Weight | 345.19 g/mol |
| Exact Mass | 344.01 |
| IUPAC Name | 2-[(E)-2-(2,4-dichlorophenyl)ethenyl]-8-nitroquinoline |
| SMILES | O=[N+]([O-])c1cccc2ccc(/C=C/c3ccc(Cl)cc3Cl)nc12 |
| InChI | InChI=1S/C17H10Cl2N2O2/c18-13-7-4-11(15(19)10-13)5-8-14-9-6-12-2-1-3-16(21(22)23)17(12)20-14/h1-10H/b8-5+ |
| InChIKey | RWXCSITZJMRWMY-VMPITWQZSA-N |
| XLogP | 5.62 |
| TPSA | 56.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.19 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|