C19H12F4N2O4 — CID 7972380
2-[(E)-2-[2,4-bis(difluoromethoxy)phenyl]ethenyl]-8-nitroquinoline (PubChem CID 7972380) has the molecular formula C19H12F4N2O4 and a molecular weight of 408.31 g/mol. Its IUPAC name is 2-[(E)-2-[2,4-bis(difluoromethoxy)phenyl]ethenyl]-8-nitroquinoline.
| Compound Name | 2-[(E)-2-[2,4-bis(difluoromethoxy)phenyl]ethenyl]-8-nitroquinoline |
|---|---|
| PubChem CID | 7972380 |
| Molecular Formula | C19H12F4N2O4 |
| Molecular Weight | 408.31 g/mol |
| Exact Mass | 408.07 |
| IUPAC Name | 2-[(E)-2-[2,4-bis(difluoromethoxy)phenyl]ethenyl]-8-nitroquinoline |
| SMILES | O=[N+]([O-])c1cccc2ccc(/C=C/c3ccc(OC(F)F)cc3OC(F)F)nc12 |
| InChI | InChI=1S/C19H12F4N2O4/c20-18(21)28-14-9-6-11(16(10-14)29-19(22)23)4-7-13-8-5-12-2-1-3-15(25(26)27)17(12)24-13/h1-10,18-19H/b7-4+ |
| InChIKey | MQDTWOHSYSDNSA-QPJJXVBHSA-N |
| XLogP | 5.52 |
| TPSA | 74.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.31 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|