C19H15ClN2O4 — CID 4820170
2-[2-(3-chloro-4,5-dimethoxyphenyl)ethenyl]-8-nitroquinoline (PubChem CID 4820170) has the molecular formula C19H15ClN2O4 and a molecular weight of 370.79 g/mol. Its IUPAC name is 2-[2-(3-chloro-4,5-dimethoxyphenyl)ethenyl]-8-nitroquinoline.
| Compound Name | 2-[2-(3-chloro-4,5-dimethoxyphenyl)ethenyl]-8-nitroquinoline |
|---|---|
| PubChem CID | 4820170 |
| Molecular Formula | C19H15ClN2O4 |
| Molecular Weight | 370.79 g/mol |
| Exact Mass | 370.07 |
| IUPAC Name | 2-[2-(3-chloro-4,5-dimethoxyphenyl)ethenyl]-8-nitroquinoline |
| SMILES | COc1cc(C=Cc2ccc3cccc([N+](=O)[O-])c3n2)cc(Cl)c1OC |
| InChI | InChI=1S/C19H15ClN2O4/c1-25-17-11-12(10-15(20)19(17)26-2)6-8-14-9-7-13-4-3-5-16(22(23)24)18(13)21-14/h3-11H,1-2H3 |
| InChIKey | UDPTYFXWLQZNHU-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 74.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.79 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|