C19H15BrN2O4 — CID 4815960
2-[2-(2-bromo-4,5-dimethoxyphenyl)ethenyl]-8-nitroquinoline (PubChem CID 4815960) has the molecular formula C19H15BrN2O4 and a molecular weight of 415.24 g/mol. Its IUPAC name is 2-[2-(2-bromo-4,5-dimethoxyphenyl)ethenyl]-8-nitroquinoline.
| Compound Name | 2-[2-(2-bromo-4,5-dimethoxyphenyl)ethenyl]-8-nitroquinoline |
|---|---|
| PubChem CID | 4815960 |
| Molecular Formula | C19H15BrN2O4 |
| Molecular Weight | 415.24 g/mol |
| Exact Mass | 414.02 |
| IUPAC Name | 2-[2-(2-bromo-4,5-dimethoxyphenyl)ethenyl]-8-nitroquinoline |
| SMILES | COc1cc(Br)c(C=Cc2ccc3cccc([N+](=O)[O-])c3n2)cc1OC |
| InChI | InChI=1S/C19H15BrN2O4/c1-25-17-10-13(15(20)11-18(17)26-2)7-9-14-8-6-12-4-3-5-16(22(23)24)19(12)21-14/h3-11H,1-2H3 |
| InChIKey | MZKATHVELYJSHP-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 74.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.24 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|