C19H12F4O4 — CID 7947943
(E)-1-(1-benzofuran-2-yl)-3-[2,4-bis(difluoromethoxy)phenyl]prop-2-en-1-one (PubChem CID 7947943) has the molecular formula C19H12F4O4 and a molecular weight of 380.29 g/mol. Its IUPAC name is (E)-1-(1-benzofuran-2-yl)-3-[2,4-bis(difluoromethoxy)phenyl]prop-2-en-1-one.
| Compound Name | (E)-1-(1-benzofuran-2-yl)-3-[2,4-bis(difluoromethoxy)phenyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 7947943 |
| Molecular Formula | C19H12F4O4 |
| Molecular Weight | 380.29 g/mol |
| Exact Mass | 380.07 |
| IUPAC Name | (E)-1-(1-benzofuran-2-yl)-3-[2,4-bis(difluoromethoxy)phenyl]prop-2-en-1-one |
| SMILES | O=C(/C=C/c1ccc(OC(F)F)cc1OC(F)F)c1cc2ccccc2o1 |
| InChI | InChI=1S/C19H12F4O4/c20-18(21)25-13-7-5-11(16(10-13)27-19(22)23)6-8-14(24)17-9-12-3-1-2-4-15(12)26-17/h1-10,18-19H/b8-6+ |
| InChIKey | RGROUXJFGMSIGK-SOFGYWHQSA-N |
| XLogP | 5.53 |
| TPSA | 48.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.29 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|