C21H18O4 — CID 51135486
(E)-1-(1-benzofuran-2-yl)-3-(5-methoxy-2-methyl-2,3-dihydro-1-benzofuran-7-yl)prop-2-en-1-one (PubChem CID 51135486) has the molecular formula C21H18O4 and a molecular weight of 334.37 g/mol. Its IUPAC name is (E)-1-(1-benzofuran-2-yl)-3-(5-methoxy-2-methyl-2,3-dihydro-1-benzofuran-7-yl)prop-2-en-1-one.
| Compound Name | (E)-1-(1-benzofuran-2-yl)-3-(5-methoxy-2-methyl-2,3-dihydro-1-benzofuran-7-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 51135486 |
| Molecular Formula | C21H18O4 |
| Molecular Weight | 334.37 g/mol |
| Exact Mass | 334.12 |
| IUPAC Name | (E)-1-(1-benzofuran-2-yl)-3-(5-methoxy-2-methyl-2,3-dihydro-1-benzofuran-7-yl)prop-2-en-1-one |
| SMILES | COc1cc(/C=C/C(=O)c2cc3ccccc3o2)c2c(c1)CC(C)O2 |
| InChI | InChI=1S/C21H18O4/c1-13-9-16-11-17(23-2)10-15(21(16)24-13)7-8-18(22)20-12-14-5-3-4-6-19(14)25-20/h3-8,10-13H,9H2,1-2H3/b8-7+ |
| InChIKey | YPBDJPABXLSYNC-BQYQJAHWSA-N |
| XLogP | 4.66 |
| TPSA | 48.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.37 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|