C19H16O4 — CID 4556919
1-(1-benzofuran-2-yl)-3-(2,4-dimethoxyphenyl)prop-2-en-1-one (PubChem CID 4556919) has the molecular formula C19H16O4 and a molecular weight of 308.33 g/mol. Its IUPAC name is 1-(1-benzofuran-2-yl)-3-(2,4-dimethoxyphenyl)prop-2-en-1-one.
| Compound Name | 1-(1-benzofuran-2-yl)-3-(2,4-dimethoxyphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 4556919 |
| Molecular Formula | C19H16O4 |
| Molecular Weight | 308.33 g/mol |
| Exact Mass | 308.10 |
| IUPAC Name | 1-(1-benzofuran-2-yl)-3-(2,4-dimethoxyphenyl)prop-2-en-1-one |
| SMILES | COc1ccc(C=CC(=O)c2cc3ccccc3o2)c(OC)c1 |
| InChI | InChI=1S/C19H16O4/c1-21-15-9-7-13(18(12-15)22-2)8-10-16(20)19-11-14-5-3-4-6-17(14)23-19/h3-12H,1-2H3 |
| InChIKey | UVICYJRROBMAPB-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 48.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.33 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|