C17H10F4NO6- — CID 8862424
4-[(E)-3-[2,4-bis(difluoromethoxy)phenyl]-3-oxoprop-1-enyl]-2-nitrophenolate (PubChem CID 8862424) has the molecular formula C17H10F4NO6- and a molecular weight of 400.26 g/mol. Its IUPAC name is 4-[(E)-3-[2,4-bis(difluoromethoxy)phenyl]-3-oxoprop-1-enyl]-2-nitrophenolate.
| Compound Name | 4-[(E)-3-[2,4-bis(difluoromethoxy)phenyl]-3-oxoprop-1-enyl]-2-nitrophenolate |
|---|---|
| PubChem CID | 8862424 |
| Molecular Formula | C17H10F4NO6- |
| Molecular Weight | 400.26 g/mol |
| Exact Mass | 400.04 |
| IUPAC Name | 4-[(E)-3-[2,4-bis(difluoromethoxy)phenyl]-3-oxoprop-1-enyl]-2-nitrophenolate |
| SMILES | O=C(/C=C/c1ccc([O-])c([N+](=O)[O-])c1)c1ccc(OC(F)F)cc1OC(F)F |
| InChI | InChI=1S/C17H11F4NO6/c18-16(19)27-10-3-4-11(15(8-10)28-17(20)21)13(23)5-1-9-2-6-14(24)12(7-9)22(25)26/h1-8,16-17,24H/p-1/b5-1+ |
| InChIKey | FXHMDHNFXLBOBX-ORCRQEGFSA-M |
| XLogP | 3.77 |
| TPSA | 101.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.26 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|