C17H11F4NO5 — CID 8862372
(E)-1-[2,4-bis(difluoromethoxy)phenyl]-3-(4-nitrophenyl)prop-2-en-1-one (PubChem CID 8862372) has the molecular formula C17H11F4NO5 and a molecular weight of 385.27 g/mol. Its IUPAC name is (E)-1-[2,4-bis(difluoromethoxy)phenyl]-3-(4-nitrophenyl)prop-2-en-1-one.
| Compound Name | (E)-1-[2,4-bis(difluoromethoxy)phenyl]-3-(4-nitrophenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 8862372 |
| Molecular Formula | C17H11F4NO5 |
| Molecular Weight | 385.27 g/mol |
| Exact Mass | 385.06 |
| IUPAC Name | (E)-1-[2,4-bis(difluoromethoxy)phenyl]-3-(4-nitrophenyl)prop-2-en-1-one |
| SMILES | O=C(/C=C/c1ccc([N+](=O)[O-])cc1)c1ccc(OC(F)F)cc1OC(F)F |
| InChI | InChI=1S/C17H11F4NO5/c18-16(19)26-12-6-7-13(15(9-12)27-17(20)21)14(23)8-3-10-1-4-11(5-2-10)22(24)25/h1-9,16-17H/b8-3+ |
| InChIKey | OLZQRQQOFPKRCW-FPYGCLRLSA-N |
| XLogP | 4.69 |
| TPSA | 78.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.27 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|