C19H19NO5 — CID 9030348
(E)-1-(2,5-diethoxyphenyl)-3-(4-nitrophenyl)prop-2-en-1-one (PubChem CID 9030348) has the molecular formula C19H19NO5 and a molecular weight of 341.36 g/mol. Its IUPAC name is (E)-1-(2,5-diethoxyphenyl)-3-(4-nitrophenyl)prop-2-en-1-one.
| Compound Name | (E)-1-(2,5-diethoxyphenyl)-3-(4-nitrophenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 9030348 |
| Molecular Formula | C19H19NO5 |
| Molecular Weight | 341.36 g/mol |
| Exact Mass | 341.13 |
| IUPAC Name | (E)-1-(2,5-diethoxyphenyl)-3-(4-nitrophenyl)prop-2-en-1-one |
| SMILES | CCOc1ccc(OCC)c(C(=O)/C=C/c2ccc([N+](=O)[O-])cc2)c1 |
| InChI | InChI=1S/C19H19NO5/c1-3-24-16-10-12-19(25-4-2)17(13-16)18(21)11-7-14-5-8-15(9-6-14)20(22)23/h5-13H,3-4H2,1-2H3/b11-7+ |
| InChIKey | AIQAKJNZXLDHPY-YRNVUSSQSA-N |
| XLogP | 4.29 |
| TPSA | 78.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.36 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|