C19H14F6O4 — CID 87841560
(E)-1-[2,5-bis(trifluoromethoxy)phenyl]-3-(4-ethoxyphenyl)prop-2-en-1-one (PubChem CID 87841560) has the molecular formula C19H14F6O4 and a molecular weight of 420.31 g/mol. Its IUPAC name is (E)-1-[2,5-bis(trifluoromethoxy)phenyl]-3-(4-ethoxyphenyl)prop-2-en-1-one.
| Compound Name | (E)-1-[2,5-bis(trifluoromethoxy)phenyl]-3-(4-ethoxyphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 87841560 |
| Molecular Formula | C19H14F6O4 |
| Molecular Weight | 420.31 g/mol |
| Exact Mass | 420.08 |
| IUPAC Name | (E)-1-[2,5-bis(trifluoromethoxy)phenyl]-3-(4-ethoxyphenyl)prop-2-en-1-one |
| SMILES | CCOc1ccc(/C=C/C(=O)c2cc(OC(F)(F)F)ccc2OC(F)(F)F)cc1 |
| InChI | InChI=1S/C19H14F6O4/c1-2-27-13-6-3-12(4-7-13)5-9-16(26)15-11-14(28-18(20,21)22)8-10-17(15)29-19(23,24)25/h3-11H,2H2,1H3/b9-5+ |
| InChIKey | JHSYONVOAMJQGE-WEVVVXLNSA-N |
| XLogP | 5.78 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.31 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|