C30H28N2O4 — CID 102288244
N,N-bis(4-ethoxyphenyl)-4-[(E)-2-(4-nitrophenyl)ethenyl]aniline (PubChem CID 102288244) has the molecular formula C30H28N2O4 and a molecular weight of 480.56 g/mol. Its IUPAC name is N,N-bis(4-ethoxyphenyl)-4-[(E)-2-(4-nitrophenyl)ethenyl]aniline.
| Compound Name | N,N-bis(4-ethoxyphenyl)-4-[(E)-2-(4-nitrophenyl)ethenyl]aniline |
|---|---|
| PubChem CID | 102288244 |
| Molecular Formula | C30H28N2O4 |
| Molecular Weight | 480.56 g/mol |
| Exact Mass | 480.20 |
| IUPAC Name | N,N-bis(4-ethoxyphenyl)-4-[(E)-2-(4-nitrophenyl)ethenyl]aniline |
| SMILES | CCOc1ccc(N(c2ccc(/C=C/c3ccc([N+](=O)[O-])cc3)cc2)c2ccc(OCC)cc2)cc1 |
| InChI | InChI=1S/C30H28N2O4/c1-3-35-29-19-15-26(16-20-29)31(27-17-21-30(22-18-27)36-4-2)25-11-7-23(8-12-25)5-6-24-9-13-28(14-10-24)32(33)34/h5-22H,3-4H2,1-2H3/b6-5+ |
| InChIKey | CBCRTPYHGUKKDO-AATRIKPKSA-N |
| XLogP | 8.03 |
| TPSA | 64.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.56 |
| LogP ≤ 5 | 8.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|