C17H18N2O5S — CID 100525941
N-(4-ethoxyphenyl)-4-nitro-N-prop-2-enylbenzenesulfonamide (PubChem CID 100525941) has the molecular formula C17H18N2O5S and a molecular weight of 362.41 g/mol. Its IUPAC name is N-(4-ethoxyphenyl)-4-nitro-N-prop-2-enylbenzenesulfonamide.
| Compound Name | N-(4-ethoxyphenyl)-4-nitro-N-prop-2-enylbenzenesulfonamide |
|---|---|
| PubChem CID | 100525941 |
| Molecular Formula | C17H18N2O5S |
| Molecular Weight | 362.41 g/mol |
| Exact Mass | 362.09 |
| IUPAC Name | N-(4-ethoxyphenyl)-4-nitro-N-prop-2-enylbenzenesulfonamide |
| SMILES | C=CCN(c1ccc(OCC)cc1)S(=O)(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C17H18N2O5S/c1-3-13-18(14-5-9-16(10-6-14)24-4-2)25(22,23)17-11-7-15(8-12-17)19(20)21/h3,5-12H,1,4,13H2,2H3 |
| InChIKey | FWUWAPINHPRYMQ-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 89.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.41 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|