C17H15ClN2O6S — CID 100529138
methyl 2-chloro-5-[(4-nitrophenyl)sulfonyl-prop-2-enylamino]benzoate (PubChem CID 100529138) has the molecular formula C17H15ClN2O6S and a molecular weight of 410.84 g/mol. Its IUPAC name is methyl 2-chloro-5-[(4-nitrophenyl)sulfonyl-prop-2-enylamino]benzoate.
| Compound Name | methyl 2-chloro-5-[(4-nitrophenyl)sulfonyl-prop-2-enylamino]benzoate |
|---|---|
| PubChem CID | 100529138 |
| Molecular Formula | C17H15ClN2O6S |
| Molecular Weight | 410.84 g/mol |
| Exact Mass | 410.03 |
| IUPAC Name | methyl 2-chloro-5-[(4-nitrophenyl)sulfonyl-prop-2-enylamino]benzoate |
| SMILES | C=CCN(c1ccc(Cl)c(C(=O)OC)c1)S(=O)(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C17H15ClN2O6S/c1-3-10-19(13-6-9-16(18)15(11-13)17(21)26-2)27(24,25)14-7-4-12(5-8-14)20(22)23/h3-9,11H,1,10H2,2H3 |
| InChIKey | NPTIDTCUYCOIIL-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 106.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.84 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|