C21H23ClN2O6S — CID 16537435
[2-(dimethylamino)-2-oxoethyl] 2-chloro-5-[(4-methoxyphenyl)-prop-2-enylsulfamoyl]benzoate (PubChem CID 16537435) has the molecular formula C21H23ClN2O6S and a molecular weight of 466.94 g/mol. Its IUPAC name is [2-(dimethylamino)-2-oxoethyl] 2-chloro-5-[(4-methoxyphenyl)-prop-2-enylsulfamoyl]benzoate.
| Compound Name | [2-(dimethylamino)-2-oxoethyl] 2-chloro-5-[(4-methoxyphenyl)-prop-2-enylsulfamoyl]benzoate |
|---|---|
| PubChem CID | 16537435 |
| Molecular Formula | C21H23ClN2O6S |
| Molecular Weight | 466.94 g/mol |
| Exact Mass | 466.10 |
| IUPAC Name | [2-(dimethylamino)-2-oxoethyl] 2-chloro-5-[(4-methoxyphenyl)-prop-2-enylsulfamoyl]benzoate |
| SMILES | C=CCN(c1ccc(OC)cc1)S(=O)(=O)c1ccc(Cl)c(C(=O)OCC(=O)N(C)C)c1 |
| InChI | InChI=1S/C21H23ClN2O6S/c1-5-12-24(15-6-8-16(29-4)9-7-15)31(27,28)17-10-11-19(22)18(13-17)21(26)30-14-20(25)23(2)3/h5-11,13H,1,12,14H2,2-4H3 |
| InChIKey | SVADURJQLHDLSO-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.94 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|