C27H25Cl2NO5S — CID 2466330
[2-oxo-2-(2,4,5-trimethylphenyl)ethyl] 2-chloro-5-[(4-chlorophenyl)-prop-2-enylsulfamoyl]benzoate (PubChem CID 2466330) has the molecular formula C27H25Cl2NO5S and a molecular weight of 546.47 g/mol. Its IUPAC name is [2-oxo-2-(2,4,5-trimethylphenyl)ethyl] 2-chloro-5-[(4-chlorophenyl)-prop-2-enylsulfamoyl]benzoate.
| Compound Name | [2-oxo-2-(2,4,5-trimethylphenyl)ethyl] 2-chloro-5-[(4-chlorophenyl)-prop-2-enylsulfamoyl]benzoate |
|---|---|
| PubChem CID | 2466330 |
| Molecular Formula | C27H25Cl2NO5S |
| Molecular Weight | 546.47 g/mol |
| Exact Mass | 545.08 |
| IUPAC Name | [2-oxo-2-(2,4,5-trimethylphenyl)ethyl] 2-chloro-5-[(4-chlorophenyl)-prop-2-enylsulfamoyl]benzoate |
| SMILES | C=CCN(c1ccc(Cl)cc1)S(=O)(=O)c1ccc(Cl)c(C(=O)OCC(=O)c2cc(C)c(C)cc2C)c1 |
| InChI | InChI=1S/C27H25Cl2NO5S/c1-5-12-30(21-8-6-20(28)7-9-21)36(33,34)22-10-11-25(29)24(15-22)27(32)35-16-26(31)23-14-18(3)17(2)13-19(23)4/h5-11,13-15H,1,12,16H2,2-4H3 |
| InChIKey | DQZUKOKARRUYNU-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.47 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|