C20H17Cl2NO6S — CID 2615058
[(3R)-2-oxooxolan-3-yl] 2-chloro-5-[(4-chlorophenyl)-prop-2-enylsulfamoyl]benzoate (PubChem CID 2615058) has the molecular formula C20H17Cl2NO6S and a molecular weight of 470.33 g/mol. Its IUPAC name is [(3R)-2-oxooxolan-3-yl] 2-chloro-5-[(4-chlorophenyl)-prop-2-enylsulfamoyl]benzoate.
| Compound Name | [(3R)-2-oxooxolan-3-yl] 2-chloro-5-[(4-chlorophenyl)-prop-2-enylsulfamoyl]benzoate |
|---|---|
| PubChem CID | 2615058 |
| Molecular Formula | C20H17Cl2NO6S |
| Molecular Weight | 470.33 g/mol |
| Exact Mass | 469.02 |
| IUPAC Name | [(3R)-2-oxooxolan-3-yl] 2-chloro-5-[(4-chlorophenyl)-prop-2-enylsulfamoyl]benzoate |
| SMILES | C=CCN(c1ccc(Cl)cc1)S(=O)(=O)c1ccc(Cl)c(C(=O)O[C@@H]2CCOC2=O)c1 |
| InChI | InChI=1S/C20H17Cl2NO6S/c1-2-10-23(14-5-3-13(21)4-6-14)30(26,27)15-7-8-17(22)16(12-15)19(24)29-18-9-11-28-20(18)25/h2-8,12,18H,1,9-11H2/t18-/m1/s1 |
| InChIKey | VEUWXTBDPVJPKV-GOSISDBHSA-N |
| XLogP | 3.85 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.33 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|