C23H20Cl2N2O3S — CID 3277354
N-benzyl-2-chloro-5-[(4-chlorophenyl)-prop-2-enylsulfamoyl]benzamide (PubChem CID 3277354) has the molecular formula C23H20Cl2N2O3S and a molecular weight of 475.40 g/mol. Its IUPAC name is N-benzyl-2-chloro-5-[(4-chlorophenyl)-prop-2-enylsulfamoyl]benzamide.
| Compound Name | N-benzyl-2-chloro-5-[(4-chlorophenyl)-prop-2-enylsulfamoyl]benzamide |
|---|---|
| PubChem CID | 3277354 |
| Molecular Formula | C23H20Cl2N2O3S |
| Molecular Weight | 475.40 g/mol |
| Exact Mass | 474.06 |
| IUPAC Name | N-benzyl-2-chloro-5-[(4-chlorophenyl)-prop-2-enylsulfamoyl]benzamide |
| SMILES | C=CCN(c1ccc(Cl)cc1)S(=O)(=O)c1ccc(Cl)c(C(=O)NCc2ccccc2)c1 |
| InChI | InChI=1S/C23H20Cl2N2O3S/c1-2-14-27(19-10-8-18(24)9-11-19)31(29,30)20-12-13-22(25)21(15-20)23(28)26-16-17-6-4-3-5-7-17/h2-13,15H,1,14,16H2,(H,26,28) |
| InChIKey | JUVVKCGUMIJRPR-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.40 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|