C22H18ClFN2O3S — CID 4611250
N-(3-chlorophenyl)-2-fluoro-5-[phenyl(prop-2-enyl)sulfamoyl]benzamide (PubChem CID 4611250) has the molecular formula C22H18ClFN2O3S and a molecular weight of 444.92 g/mol. Its IUPAC name is N-(3-chlorophenyl)-2-fluoro-5-[phenyl(prop-2-enyl)sulfamoyl]benzamide.
| Compound Name | N-(3-chlorophenyl)-2-fluoro-5-[phenyl(prop-2-enyl)sulfamoyl]benzamide |
|---|---|
| PubChem CID | 4611250 |
| Molecular Formula | C22H18ClFN2O3S |
| Molecular Weight | 444.92 g/mol |
| Exact Mass | 444.07 |
| IUPAC Name | N-(3-chlorophenyl)-2-fluoro-5-[phenyl(prop-2-enyl)sulfamoyl]benzamide |
| SMILES | C=CCN(c1ccccc1)S(=O)(=O)c1ccc(F)c(C(=O)Nc2cccc(Cl)c2)c1 |
| InChI | InChI=1S/C22H18ClFN2O3S/c1-2-13-26(18-9-4-3-5-10-18)30(28,29)19-11-12-21(24)20(15-19)22(27)25-17-8-6-7-16(23)14-17/h2-12,14-15H,1,13H2,(H,25,27) |
| InChIKey | MUOZUFXPAXASME-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.92 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|