C24H27FN2O3S — CID 3333418
N-[2-(cyclohexen-1-yl)ethyl]-2-fluoro-5-[phenyl(prop-2-enyl)sulfamoyl]benzamide (PubChem CID 3333418) has the molecular formula C24H27FN2O3S and a molecular weight of 442.56 g/mol. Its IUPAC name is N-[2-(cyclohexen-1-yl)ethyl]-2-fluoro-5-[phenyl(prop-2-enyl)sulfamoyl]benzamide.
| Compound Name | N-[2-(cyclohexen-1-yl)ethyl]-2-fluoro-5-[phenyl(prop-2-enyl)sulfamoyl]benzamide |
|---|---|
| PubChem CID | 3333418 |
| Molecular Formula | C24H27FN2O3S |
| Molecular Weight | 442.56 g/mol |
| Exact Mass | 442.17 |
| IUPAC Name | N-[2-(cyclohexen-1-yl)ethyl]-2-fluoro-5-[phenyl(prop-2-enyl)sulfamoyl]benzamide |
| SMILES | C=CCN(c1ccccc1)S(=O)(=O)c1ccc(F)c(C(=O)NCCC2=CCCCC2)c1 |
| InChI | InChI=1S/C24H27FN2O3S/c1-2-17-27(20-11-7-4-8-12-20)31(29,30)21-13-14-23(25)22(18-21)24(28)26-16-15-19-9-5-3-6-10-19/h2,4,7-9,11-14,18H,1,3,5-6,10,15-17H2,(H,26,28) |
| InChIKey | TXQHHNREYWNJIE-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.56 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|