C18H25FN2O3S — CID 55604780
N-[2-(cyclohexen-1-yl)ethyl]-2-fluoro-5-(propan-2-ylsulfamoyl)benzamide (PubChem CID 55604780) has the molecular formula C18H25FN2O3S and a molecular weight of 368.47 g/mol. Its IUPAC name is N-[2-(cyclohexen-1-yl)ethyl]-2-fluoro-5-(propan-2-ylsulfamoyl)benzamide.
| Compound Name | N-[2-(cyclohexen-1-yl)ethyl]-2-fluoro-5-(propan-2-ylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 55604780 |
| Molecular Formula | C18H25FN2O3S |
| Molecular Weight | 368.47 g/mol |
| Exact Mass | 368.16 |
| IUPAC Name | N-[2-(cyclohexen-1-yl)ethyl]-2-fluoro-5-(propan-2-ylsulfamoyl)benzamide |
| SMILES | CC(C)NS(=O)(=O)c1ccc(F)c(C(=O)NCCC2=CCCCC2)c1 |
| InChI | InChI=1S/C18H25FN2O3S/c1-13(2)21-25(23,24)15-8-9-17(19)16(12-15)18(22)20-11-10-14-6-4-3-5-7-14/h6,8-9,12-13,21H,3-5,7,10-11H2,1-2H3,(H,20,22) |
| InChIKey | VQBPXORUWQIDCK-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.47 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|