C25H23ClN2O5S — CID 40895172
[2-(3-methylanilino)-2-oxoethyl] 2-chloro-5-[phenyl(prop-2-enyl)sulfamoyl]benzoate (PubChem CID 40895172) has the molecular formula C25H23ClN2O5S and a molecular weight of 498.99 g/mol. Its IUPAC name is [2-(3-methylanilino)-2-oxoethyl] 2-chloro-5-[phenyl(prop-2-enyl)sulfamoyl]benzoate.
| Compound Name | [2-(3-methylanilino)-2-oxoethyl] 2-chloro-5-[phenyl(prop-2-enyl)sulfamoyl]benzoate |
|---|---|
| PubChem CID | 40895172 |
| Molecular Formula | C25H23ClN2O5S |
| Molecular Weight | 498.99 g/mol |
| Exact Mass | 498.10 |
| IUPAC Name | [2-(3-methylanilino)-2-oxoethyl] 2-chloro-5-[phenyl(prop-2-enyl)sulfamoyl]benzoate |
| SMILES | C=CCN(c1ccccc1)S(=O)(=O)c1ccc(Cl)c(C(=O)OCC(=O)Nc2cccc(C)c2)c1 |
| InChI | InChI=1S/C25H23ClN2O5S/c1-3-14-28(20-10-5-4-6-11-20)34(31,32)21-12-13-23(26)22(16-21)25(30)33-17-24(29)27-19-9-7-8-18(2)15-19/h3-13,15-16H,1,14,17H2,2H3,(H,27,29) |
| InChIKey | BFTKDLYPQUVLNN-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.99 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|